C30H40N2O7S — CID 18648481
[(2S,4R)-2-[3-(3,5-dipropoxyphenyl)propyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 18648481) has the molecular formula C30H40N2O7S and a molecular weight of 572.72 g/mol. Its IUPAC name is [(2S,4R)-2-[3-(3,5-dipropoxyphenyl)propyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R)-2-[3-(3,5-dipropoxyphenyl)propyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18648481 |
| Molecular Formula | C30H40N2O7S |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [(2S,4R)-2-[3-(3,5-dipropoxyphenyl)propyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCOc1cc(CCC[C@]2(Cn3ccnc3)OC[C@H](COS(=O)(=O)c3ccc(C)cc3)O2)cc(OCCC)c1 |
| InChI | InChI=1S/C30H40N2O7S/c1-4-15-35-26-17-25(18-27(19-26)36-16-5-2)7-6-12-30(22-32-14-13-31-23-32)37-20-28(39-30)21-38-40(33,34)29-10-8-24(3)9-11-29/h8-11,13-14,17-19,23,28H,4-7,12,15-16,20-22H2,1-3H3/t28-,30+/m1/s1 |
| InChIKey | UVDRNHWELBEDRT-DGPALRBDSA-N |
| XLogP | 5.31 |
| TPSA | 98.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|