C22H25N5O4S — CID 23461035
1-amino-3-[4-[[2-(imidazol-1-ylmethyl)-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]thiourea (PubChem CID 23461035) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 1-amino-3-[4-[[2-(imidazol-1-ylmethyl)-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]thiourea.
| Compound Name | 1-amino-3-[4-[[2-(imidazol-1-ylmethyl)-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 23461035 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 1-amino-3-[4-[[2-(imidazol-1-ylmethyl)-2-(4-methoxyphenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]thiourea |
| SMILES | COc1ccc(C2(Cn3ccnc3)OCC(COc3ccc(NC(=S)NN)cc3)O2)cc1 |
| InChI | InChI=1S/C22H25N5O4S/c1-28-18-6-2-16(3-7-18)22(14-27-11-10-24-15-27)30-13-20(31-22)12-29-19-8-4-17(5-9-19)25-21(32)26-23/h2-11,15,20H,12-14,23H2,1H3,(H2,25,26,32) |
| InChIKey | PGUFBSNAFGYOCM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|