C18H16BrClO4 — CID 67001670
[(4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 67001670) has the molecular formula C18H16BrClO4 and a molecular weight of 411.68 g/mol. Its IUPAC name is [(4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [(4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 67001670 |
| Molecular Formula | C18H16BrClO4 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [(4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1COC(CBr)(c2ccc(Cl)cc2)O1)c1ccccc1 |
| InChI | InChI=1S/C18H16BrClO4/c19-12-18(14-6-8-15(20)9-7-14)23-11-16(24-18)10-22-17(21)13-4-2-1-3-5-13/h1-9,16H,10-12H2/t16-,18?/m1/s1 |
| InChIKey | NFCOZKIMZKSQOA-PYUWXLGESA-N |
| XLogP | 4.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|