C15H20BrClO3S — CID 143933594
(E)-[(2S,4S)-2-(bromomethyl)-2-(4-chloro-2-methylphenyl)-1,3-dioxolan-4-yl]methoxy-ethylidene-methyl-λ4-sulfane (PubChem CID 143933594) has the molecular formula C15H20BrClO3S and a molecular weight of 395.75 g/mol. Its IUPAC name is (E)-[(2S,4S)-2-(bromomethyl)-2-(4-chloro-2-methylphenyl)-1,3-dioxolan-4-yl]methoxy-ethylidene-methyl-λ4-sulfane.
| Compound Name | (E)-[(2S,4S)-2-(bromomethyl)-2-(4-chloro-2-methylphenyl)-1,3-dioxolan-4-yl]methoxy-ethylidene-methyl-λ4-sulfane |
|---|---|
| PubChem CID | 143933594 |
| Molecular Formula | C15H20BrClO3S |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | (E)-[(2S,4S)-2-(bromomethyl)-2-(4-chloro-2-methylphenyl)-1,3-dioxolan-4-yl]methoxy-ethylidene-methyl-λ4-sulfane |
| SMILES | C/C=S(\C)OC[C@@H]1CO[C@@](CBr)(c2ccc(Cl)cc2C)O1 |
| InChI | InChI=1S/C15H20BrClO3S/c1-4-21(3)19-9-13-8-18-15(10-16,20-13)14-6-5-12(17)7-11(14)2/h4-7,13H,8-10H2,1-3H3/t13-,15+,21?/m0/s1 |
| InChIKey | SCSNWOBJDFXUHL-YTTLREONSA-N |
| XLogP | 4.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|