C26H35ClN2O3 — CID 143164360
1-[4-[[(2S)-2-(4-chloro-2-methylphenyl)-2-ethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-4-propan-2-ylpiperazine (PubChem CID 143164360) has the molecular formula C26H35ClN2O3 and a molecular weight of 459.03 g/mol. Its IUPAC name is 1-[4-[[(2S)-2-(4-chloro-2-methylphenyl)-2-ethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[4-[[(2S)-2-(4-chloro-2-methylphenyl)-2-ethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 143164360 |
| Molecular Formula | C26H35ClN2O3 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 1-[4-[[(2S)-2-(4-chloro-2-methylphenyl)-2-ethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-4-propan-2-ylpiperazine |
| SMILES | CC[C@]1(c2ccc(Cl)cc2C)OCC(COc2ccc(N3CCN(C(C)C)CC3)cc2)O1 |
| InChI | InChI=1S/C26H35ClN2O3/c1-5-26(25-11-6-21(27)16-20(25)4)31-18-24(32-26)17-30-23-9-7-22(8-10-23)29-14-12-28(13-15-29)19(2)3/h6-11,16,19,24H,5,12-15,17-18H2,1-4H3/t24?,26-/m0/s1 |
| InChIKey | BLHDLYQTGMUVGK-JKGBFCRXSA-N |
| XLogP | 5.24 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|