C36H40Cl2N8O4 — CID 121404946
2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1,4-diazepan-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 121404946) has the molecular formula C36H40Cl2N8O4 and a molecular weight of 719.67 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1,4-diazepan-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1,4-diazepan-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121404946 |
| Molecular Formula | C36H40Cl2N8O4 |
| Molecular Weight | 719.67 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1,4-diazepan-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCCN(c4ccc(OC[C@@H]5CO[C@@](Cn6nccn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C36H40Cl2N8O4/c1-3-26(2)46-35(47)44(25-41-46)30-8-6-28(7-9-30)42-17-4-18-43(20-19-42)29-10-12-31(13-11-29)48-22-32-23-49-36(50-32,24-45-39-15-16-40-45)33-14-5-27(37)21-34(33)38/h5-16,21,25-26,32H,3-4,17-20,22-24H2,1-2H3/t26?,32-,36-/m1/s1 |
| InChIKey | PUXPSSUFOOVTIY-YOJHGRMCSA-N |
| XLogP | 5.97 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|