C31H30Cl2N6O4 — CID 121404911
2-butan-2-yl-4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]phenyl]-1,2,4-triazol-3-one (PubChem CID 121404911) has the molecular formula C31H30Cl2N6O4 and a molecular weight of 621.53 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121404911 |
| Molecular Formula | C31H30Cl2N6O4 |
| Molecular Weight | 621.53 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(-c3ccc(OC[C@@H]4CO[C@@](Cn5nccn5)(c5ccc(Cl)cc5Cl)O4)cc3)cc2)c1=O |
| InChI | InChI=1S/C31H30Cl2N6O4/c1-3-21(2)39-30(40)37(20-36-39)25-9-4-22(5-10-25)23-6-11-26(12-7-23)41-17-27-18-42-31(43-27,19-38-34-14-15-35-38)28-13-8-24(32)16-29(28)33/h4-16,20-21,27H,3,17-19H2,1-2H3/t21?,27-,31-/m1/s1 |
| InChIKey | PEKAVZHTFFTHNI-RKZDBKGKSA-N |
| XLogP | 5.92 |
| TPSA | 98.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |