C12H15Cl3O2 — CID 143933612
2-(chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane;ethane (PubChem CID 143933612) has the molecular formula C12H15Cl3O2 and a molecular weight of 297.61 g/mol. Its IUPAC name is 2-(chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane;ethane.
| Compound Name | 2-(chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane;ethane |
|---|---|
| PubChem CID | 143933612 |
| Molecular Formula | C12H15Cl3O2 |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-(chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane;ethane |
| SMILES | CC.ClCC1(c2ccc(Cl)cc2Cl)OCCO1 |
| InChI | InChI=1S/C10H9Cl3O2.C2H6/c11-6-10(14-3-4-15-10)8-2-1-7(12)5-9(8)13;1-2/h1-2,5H,3-4,6H2;1-2H3 |
| InChIKey | YMBJHHOGKRTCJV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|