C11H9Cl2N3O2 — CID 70151004
5-[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]-1H-1,2,4-triazole (PubChem CID 70151004) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 70151004 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 5-[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]-1H-1,2,4-triazole |
| SMILES | Clc1ccc(C2(c3ncn[nH]3)OCCO2)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c12-7-1-2-8(9(13)5-7)11(17-3-4-18-11)10-14-6-15-16-10/h1-2,5-6H,3-4H2,(H,14,15,16) |
| InChIKey | QWWPFVDAJDSVHL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |