C9H8Cl2O2 — CID 83690306
3-(2,4-dichlorophenyl)oxetan-3-ol (PubChem CID 83690306) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)oxetan-3-ol.
| Compound Name | 3-(2,4-dichlorophenyl)oxetan-3-ol |
|---|---|
| PubChem CID | 83690306 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)oxetan-3-ol |
| SMILES | OC1(c2ccc(Cl)cc2Cl)COC1 |
| InChI | InChI=1S/C9H8Cl2O2/c10-6-1-2-7(8(11)3-6)9(12)4-13-5-9/h1-3,12H,4-5H2 |
| InChIKey | IEDIGWQROOEHIS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |