C10H9Cl2FO — CID 86098371
2-(2,4-dichlorophenyl)-2-(1-fluoroethyl)oxirane (PubChem CID 86098371) has the molecular formula C10H9Cl2FO and a molecular weight of 235.09 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-(1-fluoroethyl)oxirane.
| Compound Name | 2-(2,4-dichlorophenyl)-2-(1-fluoroethyl)oxirane |
|---|---|
| PubChem CID | 86098371 |
| Molecular Formula | C10H9Cl2FO |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-(1-fluoroethyl)oxirane |
| SMILES | CC(F)C1(c2ccc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C10H9Cl2FO/c1-6(13)10(5-14-10)8-3-2-7(11)4-9(8)12/h2-4,6H,5H2,1H3 |
| InChIKey | BVHPIOXFLRYWAF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|