About 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine
2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine (PubChem CID 54113833) has the molecular formula C13H15Cl2NO2
and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine.
Molecular Properties
| Compound Name | 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine |
| PubChem CID | 54113833 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine |
| SMILES | CON=CC(C)(C)C1(c2ccc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C13H15Cl2NO2/c1-12(2,7-16-17-3)13(8-18-13)10-5-4-9(14)6-11(10)15/h4-7H,8H2,1-3H3 |
| InChIKey | NIYHDQYKTWHAJI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine?
The IUPAC name of 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine (CID 54113833) is 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine.
What is the SMILES notation for 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine?
The canonical SMILES for 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine is CON=CC(C)(C)C1(c2ccc(Cl)cc2Cl)CO1.
What is the InChIKey of 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine?
The InChIKey is NIYHDQYKTWHAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO2/c1-12(2,7-16-17-3)13(8-18-13)10-5-4-9(14)6-11(10)15/h4-7H,8H2,1-3H3.
What are the key properties of 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine?
2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine has a molecular weight of 288.17 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenyl)oxiran-2-yl]-N-methoxy-2-methylpropan-1-imine is sourced from PubChem (CID 54113833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).