C13H13Cl2NO2 — CID 64904393
1-(2,4-dichlorophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile (PubChem CID 64904393) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile.
| Compound Name | 1-(2,4-dichlorophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 64904393 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile |
| SMILES | COC1(OC)CC(C#N)(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H13Cl2NO2/c1-17-13(18-2)6-12(7-13,8-16)10-4-3-9(14)5-11(10)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | HZMIERODQUHEIB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|