C15H17NO4 — CID 64906048
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-dimethoxycyclobutane-1-carbonitrile (PubChem CID 64906048) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-dimethoxycyclobutane-1-carbonitrile.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-dimethoxycyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 64906048 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-dimethoxycyclobutane-1-carbonitrile |
| SMILES | COC1(OC)CC(C#N)(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C15H17NO4/c1-17-15(18-2)8-14(9-15,10-16)11-3-4-12-13(7-11)20-6-5-19-12/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | JSUDYFUAERHKMU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|