C23H22O5 — CID 19973671
bis[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]methanone (PubChem CID 19973671) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is bis[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]methanone.
| Compound Name | bis[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 19973671 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | bis[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopropyl]methanone |
| SMILES | O=C(C1(c2ccc3c(c2)OCCO3)CC1)C1(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C23H22O5/c24-21(22(5-6-22)15-1-3-17-19(13-15)27-11-9-25-17)23(7-8-23)16-2-4-18-20(14-16)28-12-10-26-18/h1-4,13-14H,5-12H2 |
| InChIKey | SDOQUHWLLIFLDB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |