4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride

C14H15ClO4 — CID 172907265

IUPAC4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc3c(c2)OCCO3)CCOCC1
InChIInChI=1S/C14H15ClO4/c15-13(16)14(3-5-17-6-4-14)10-1-2-11-12(9-10)19-8-7-18-11/h1-2,9H,3-8H2
InChIKeyVZDHVQKWFHSHQF-UHFFFAOYSA-N
MW282.72 g/mol
LogP2.27
Rot. Bonds2

About 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride

4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride (PubChem CID 172907265) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride.

Molecular Properties

Compound Name4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride
PubChem CID172907265
Molecular FormulaC14H15ClO4
Molecular Weight282.72 g/mol
Exact Mass282.07
IUPAC Name4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc3c(c2)OCCO3)CCOCC1
InChIInChI=1S/C14H15ClO4/c15-13(16)14(3-5-17-6-4-14)10-1-2-11-12(9-10)19-8-7-18-11/h1-2,9H,3-8H2
InChIKeyVZDHVQKWFHSHQF-UHFFFAOYSA-N
XLogP2.27
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.72
LogP ≤ 52.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride?
The IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride (CID 172907265) is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride.
What is the SMILES notation for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride?
The canonical SMILES for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride is O=C(Cl)C1(c2ccc3c(c2)OCCO3)CCOCC1.
What is the InChIKey of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride?
The InChIKey is VZDHVQKWFHSHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClO4/c15-13(16)14(3-5-17-6-4-14)10-1-2-11-12(9-10)19-8-7-18-11/h1-2,9H,3-8H2.
What are the key properties of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride?
4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride has a molecular weight of 282.72 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)oxane-4-carbonyl chloride is sourced from PubChem (CID 172907265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).