4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride

C13H13ClO4 — CID 172994841

IUPAC4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc3c(c2)OCO3)CCOCC1
InChIInChI=1S/C13H13ClO4/c14-12(15)13(3-5-16-6-4-13)9-1-2-10-11(7-9)18-8-17-10/h1-2,7H,3-6,8H2
InChIKeyKZRWXGWHLMDVNO-UHFFFAOYSA-N
MW268.70 g/mol
LogP2.23
Rot. Bonds2

About 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride

4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride (PubChem CID 172994841) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride.

Molecular Properties

Compound Name4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride
PubChem CID172994841
Molecular FormulaC13H13ClO4
Molecular Weight268.70 g/mol
Exact Mass268.05
IUPAC Name4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc3c(c2)OCO3)CCOCC1
InChIInChI=1S/C13H13ClO4/c14-12(15)13(3-5-16-6-4-13)9-1-2-10-11(7-9)18-8-17-10/h1-2,7H,3-6,8H2
InChIKeyKZRWXGWHLMDVNO-UHFFFAOYSA-N
XLogP2.23
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.70
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride (CID 172994841) is 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride is O=C(Cl)C1(c2ccc3c(c2)OCO3)CCOCC1.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride?
The InChIKey is KZRWXGWHLMDVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO4/c14-12(15)13(3-5-16-6-4-13)9-1-2-10-11(7-9)18-8-17-10/h1-2,7H,3-6,8H2.
What are the key properties of 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride?
4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride has a molecular weight of 268.70 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)oxane-4-carbonyl chloride is sourced from PubChem (CID 172994841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).