C10H10O4 — CID 75406892
3-(1,3-benzodioxol-5-yl)oxetan-3-ol (PubChem CID 75406892) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)oxetan-3-ol.
| Compound Name | 3-(1,3-benzodioxol-5-yl)oxetan-3-ol |
|---|---|
| PubChem CID | 75406892 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)oxetan-3-ol |
| SMILES | OC1(c2ccc3c(c2)OCO3)COC1 |
| InChI | InChI=1S/C10H10O4/c11-10(4-12-5-10)7-1-2-8-9(3-7)14-6-13-8/h1-3,11H,4-6H2 |
| InChIKey | MRNAXDURSOMYRD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |