C18H18FNO5S — CID 652940
4-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)sulfonylpiperidin-4-ol (PubChem CID 652940) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)sulfonylpiperidin-4-ol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)sulfonylpiperidin-4-ol |
|---|---|
| PubChem CID | 652940 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)sulfonylpiperidin-4-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCC(O)(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H18FNO5S/c19-14-2-4-15(5-3-14)26(22,23)20-9-7-18(21,8-10-20)13-1-6-16-17(11-13)25-12-24-16/h1-6,11,21H,7-10,12H2 |
| InChIKey | CJNYSNNQEYIOAH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |