C17H16FNO5S — CID 110326793
4-(1,3-benzodioxol-5-ylsulfonyl)-2-(4-fluorophenyl)morpholine (PubChem CID 110326793) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylsulfonyl)-2-(4-fluorophenyl)morpholine.
| Compound Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-2-(4-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 110326793 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-2-(4-fluorophenyl)morpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H16FNO5S/c18-13-3-1-12(2-4-13)17-10-19(7-8-22-17)25(20,21)14-5-6-15-16(9-14)24-11-23-15/h1-6,9,17H,7-8,10-11H2 |
| InChIKey | GSOOGPKGZGSEJN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |