C13H14O3 — CID 10398467
1-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-ol (PubChem CID 10398467) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10398467 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)cyclohex-2-en-1-ol |
| SMILES | OC1(c2ccc3c(c2)OCO3)C=CCCC1 |
| InChI | InChI=1S/C13H14O3/c14-13(6-2-1-3-7-13)10-4-5-11-12(8-10)16-9-15-11/h2,4-6,8,14H,1,3,7,9H2 |
| InChIKey | SLZQSRGOANTSHE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|