C16H22N2O4 — CID 119303789
3-amino-N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]propanamide (PubChem CID 119303789) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-amino-N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 119303789 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-amino-N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C16H22N2O4/c17-6-3-15(19)18-10-16(4-7-20-8-5-16)12-1-2-13-14(9-12)22-11-21-13/h1-2,9H,3-8,10-11,17H2,(H,18,19) |
| InChIKey | NZCLJWLAQSZHIC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |