C22H32N2O5 — CID 56522025
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N',N'-diethylpentanediamide (PubChem CID 56522025) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N',N'-diethylpentanediamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N',N'-diethylpentanediamide |
|---|---|
| PubChem CID | 56522025 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N',N'-diethylpentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C22H32N2O5/c1-3-24(4-2)21(26)7-5-6-20(25)23-15-22(10-12-27-13-11-22)17-8-9-18-19(14-17)29-16-28-18/h8-9,14H,3-7,10-13,15-16H2,1-2H3,(H,23,25) |
| InChIKey | AUCXUHYUZLWHEB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |