C22H19F6NO4 — CID 60586891
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 60586891) has the molecular formula C22H19F6NO4 and a molecular weight of 475.39 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 60586891 |
| Molecular Formula | C22H19F6NO4 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(c2ccc3c(c2)OCO3)CCOCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F6NO4/c23-21(24,25)15-7-13(8-16(9-15)22(26,27)28)19(30)29-11-20(3-5-31-6-4-20)14-1-2-17-18(10-14)33-12-32-17/h1-2,7-10H,3-6,11-12H2,(H,29,30) |
| InChIKey | XLDDFADNGHGFKC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |