C23H22N2O4 — CID 47873825
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]quinoline-2-carboxamide (PubChem CID 47873825) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]quinoline-2-carboxamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 47873825 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]quinoline-2-carboxamide |
| SMILES | O=C(NCC1(c2ccc3c(c2)OCO3)CCOCC1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C23H22N2O4/c26-22(19-7-5-16-3-1-2-4-18(16)25-19)24-14-23(9-11-27-12-10-23)17-6-8-20-21(13-17)29-15-28-20/h1-8,13H,9-12,14-15H2,(H,24,26) |
| InChIKey | AKTWHURVJQGMRQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |