C19H19ClN2O4 — CID 60586843
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-6-chloropyridine-3-carboxamide (PubChem CID 60586843) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 60586843 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-6-chloropyridine-3-carboxamide |
| SMILES | O=C(NCC1(c2ccc3c(c2)OCO3)CCOCC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H19ClN2O4/c20-17-4-1-13(10-21-17)18(23)22-11-19(5-7-24-8-6-19)14-2-3-15-16(9-14)26-12-25-15/h1-4,9-10H,5-8,11-12H2,(H,22,23) |
| InChIKey | XYKKRZUYHAKSKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|