C13H13F2NO4S — CID 64904408
1-(2,5-difluorophenyl)sulfonyl-3,3-dimethoxycyclobutane-1-carbonitrile (PubChem CID 64904408) has the molecular formula C13H13F2NO4S and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-3,3-dimethoxycyclobutane-1-carbonitrile.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-3,3-dimethoxycyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 64904408 |
| Molecular Formula | C13H13F2NO4S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-3,3-dimethoxycyclobutane-1-carbonitrile |
| SMILES | COC1(OC)CC(C#N)(S(=O)(=O)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C13H13F2NO4S/c1-19-13(20-2)6-12(7-13,8-16)21(17,18)11-5-9(14)3-4-10(11)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | QQUZTYTVQBXRBO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|