C11H12Cl2O3S — CID 175102349
methyl [1-(2,4-dichlorophenyl)cyclopropyl]methanesulfonate (PubChem CID 175102349) has the molecular formula C11H12Cl2O3S and a molecular weight of 295.19 g/mol. Its IUPAC name is methyl [1-(2,4-dichlorophenyl)cyclopropyl]methanesulfonate.
| Compound Name | methyl [1-(2,4-dichlorophenyl)cyclopropyl]methanesulfonate |
|---|---|
| PubChem CID | 175102349 |
| Molecular Formula | C11H12Cl2O3S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | methyl [1-(2,4-dichlorophenyl)cyclopropyl]methanesulfonate |
| SMILES | COS(=O)(=O)CC1(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H12Cl2O3S/c1-16-17(14,15)7-11(4-5-11)9-3-2-8(12)6-10(9)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HRJBFKNHWJWVHC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|