C12H13Cl2N — CID 65353243
[1-(2,4-dichlorophenyl)cyclopent-3-en-1-yl]methanamine (PubChem CID 65353243) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)cyclopent-3-en-1-yl]methanamine.
| Compound Name | [1-(2,4-dichlorophenyl)cyclopent-3-en-1-yl]methanamine |
|---|---|
| PubChem CID | 65353243 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | [1-(2,4-dichlorophenyl)cyclopent-3-en-1-yl]methanamine |
| SMILES | NCC1(c2ccc(Cl)cc2Cl)CC=CC1 |
| InChI | InChI=1S/C12H13Cl2N/c13-9-3-4-10(11(14)7-9)12(8-15)5-1-2-6-12/h1-4,7H,5-6,8,15H2 |
| InChIKey | PHLLXUSMMUFPBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|