C14H19Cl2N — CID 65013516
[1-(2,4-dichlorophenyl)-3-propylcyclobutyl]methanamine (PubChem CID 65013516) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-3-propylcyclobutyl]methanamine.
| Compound Name | [1-(2,4-dichlorophenyl)-3-propylcyclobutyl]methanamine |
|---|---|
| PubChem CID | 65013516 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-3-propylcyclobutyl]methanamine |
| SMILES | CCCC1CC(CN)(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2N/c1-2-3-10-7-14(8-10,9-17)12-5-4-11(15)6-13(12)16/h4-6,10H,2-3,7-9,17H2,1H3 |
| InChIKey | XFDDWFCCAYXSDR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |