C14H18Cl2O2 — CID 164706205
2-(2,4-dichlorophenyl)-4-ethyl-2-propan-2-yl-1,3-dioxolane (PubChem CID 164706205) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-ethyl-2-propan-2-yl-1,3-dioxolane.
| Compound Name | 2-(2,4-dichlorophenyl)-4-ethyl-2-propan-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 164706205 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-ethyl-2-propan-2-yl-1,3-dioxolane |
| SMILES | CCC1COC(c2ccc(Cl)cc2Cl)(C(C)C)O1 |
| InChI | InChI=1S/C14H18Cl2O2/c1-4-11-8-17-14(18-11,9(2)3)12-6-5-10(15)7-13(12)16/h5-7,9,11H,4,8H2,1-3H3 |
| InChIKey | AGLCMGKZFMRELU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |