C12H13Cl2N3O6S — CID 70607270
1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;sulfuric acid (PubChem CID 70607270) has the molecular formula C12H13Cl2N3O6S and a molecular weight of 398.22 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;sulfuric acid.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;sulfuric acid |
|---|---|
| PubChem CID | 70607270 |
| Molecular Formula | C12H13Cl2N3O6S |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;sulfuric acid |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCCO2)c(Cl)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C12H11Cl2N3O2.H2O4S/c13-9-1-2-10(11(14)5-9)12(18-3-4-19-12)6-17-8-15-7-16-17;1-5(2,3)4/h1-2,5,7-8H,3-4,6H2;(H2,1,2,3,4) |
| InChIKey | ZLUCUCBUHWVNPN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|