C14H16ClN3O7 — CID 70607194
1-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;oxalic acid;hydrate (PubChem CID 70607194) has the molecular formula C14H16ClN3O7 and a molecular weight of 373.75 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;oxalic acid;hydrate.
| Compound Name | 1-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;oxalic acid;hydrate |
|---|---|
| PubChem CID | 70607194 |
| Molecular Formula | C14H16ClN3O7 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;oxalic acid;hydrate |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCCO2)cc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H12ClN3O2.C2H2O4.H2O/c13-11-3-1-10(2-4-11)12(17-5-6-18-12)7-16-9-14-8-15-16;3-1(4)2(5)6;/h1-4,8-9H,5-7H2;(H,3,4)(H,5,6);1H2 |
| InChIKey | WCLQZAJFILBZJD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|