C13H14ClN3O2S — CID 10380776
[(2R,4S)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanethiol (PubChem CID 10380776) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is [(2R,4S)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanethiol.
| Compound Name | [(2R,4S)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanethiol |
|---|---|
| PubChem CID | 10380776 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | [(2R,4S)-2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanethiol |
| SMILES | SC[C@@H]1CO[C@](Cn2cncn2)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-11-3-1-10(2-4-11)13(7-17-9-15-8-16-17)18-5-12(6-20)19-13/h1-4,8-9,12,20H,5-7H2/t12-,13-/m0/s1 |
| InChIKey | VZFXNLCSOWYHEB-STQMWFEESA-N |
| XLogP | 2.13 |
| TPSA | 49.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|