C12H11N3O2 — CID 156783536
1-[(2-phenyl-1,3-dioxol-2-yl)methyl]-1,2,4-triazole (PubChem CID 156783536) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-[(2-phenyl-1,3-dioxol-2-yl)methyl]-1,2,4-triazole.
| Compound Name | 1-[(2-phenyl-1,3-dioxol-2-yl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 156783536 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-[(2-phenyl-1,3-dioxol-2-yl)methyl]-1,2,4-triazole |
| SMILES | C1=COC(Cn2cncn2)(c2ccccc2)O1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-4-11(5-3-1)12(16-6-7-17-12)8-15-10-13-9-14-15/h1-7,9-10H,8H2 |
| InChIKey | SJUCYDUJZCDOMD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |