C27H27Cl5N6O4 — CID 155128310
1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide (PubChem CID 155128310) has the molecular formula C27H27Cl5N6O4 and a molecular weight of 676.82 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 155128310 |
| Molecular Formula | C27H27Cl5N6O4 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 674.05 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1.Clc1ccc(C2(Cn3cncn3)OCCO2)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl3N3O2.C12H11Cl2N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;13-9-1-2-10(11(14)5-9)12(18-3-4-19-12)6-17-8-15-7-16-17/h3,5,8-10H,2,4,6-7H2,1H3;1-2,5,7-8H,3-4,6H2 |
| InChIKey | HBIWIUUHEIIMAT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 96.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |