C26H35Cl3N4O4Si — CID 68826389
N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide;1-(1-trimethylsilylethoxymethyl)pyridin-4-one (PubChem CID 68826389) has the molecular formula C26H35Cl3N4O4Si and a molecular weight of 602.04 g/mol. Its IUPAC name is N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide;1-(1-trimethylsilylethoxymethyl)pyridin-4-one.
| Compound Name | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide;1-(1-trimethylsilylethoxymethyl)pyridin-4-one |
|---|---|
| PubChem CID | 68826389 |
| Molecular Formula | C26H35Cl3N4O4Si |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide;1-(1-trimethylsilylethoxymethyl)pyridin-4-one |
| SMILES | CC(OCn1ccc(=O)cc1)[Si](C)(C)C.CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n1ccnc1 |
| InChI | InChI=1S/C15H16Cl3N3O2.C11H19NO2Si/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;1-10(15(2,3)4)14-9-12-7-5-11(13)6-8-12/h3,5,8-10H,2,4,6-7H2,1H3;5-8,10H,9H2,1-4H3 |
| InChIKey | BLVIQMVESOUYKT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|