C16H9BrCl4O2 — CID 3892077
[3-(bromomethyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 3892077) has the molecular formula C16H9BrCl4O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is [3-(bromomethyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [3-(bromomethyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 3892077 |
| Molecular Formula | C16H9BrCl4O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 451.85 |
| IUPAC Name | [3-(bromomethyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C1OC1(CBr)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9BrCl4O2/c17-7-16(11-4-2-9(19)6-13(11)21)15(23-16)14(22)10-3-1-8(18)5-12(10)20/h1-6,15H,7H2 |
| InChIKey | MXBHCTXNQDNXRS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|