About (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate
(4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599628) has the molecular formula C11H9ClO5
and a molecular weight of 256.64 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate.
Analyze (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate (CID 134599628) is (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate is O=C1OCC(C(=O)OCc2ccc(Cl)cc2)O1.
What is the InChIKey of (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate?
The InChIKey is QCXABUCPHYRKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO5/c12-8-3-1-7(2-4-8)5-15-10(13)9-6-16-11(14)17-9/h1-4,9H,5-6H2.
What are the key properties of (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate?
(4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate has a molecular weight of 256.64 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 2-oxo-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 134599628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).