C10H10O10 — CID 122643704
2-(2-oxo-1,3-dioxolane-4-carbonyl)oxyethyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 122643704) has the molecular formula C10H10O10 and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dioxolane-4-carbonyl)oxyethyl 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | 2-(2-oxo-1,3-dioxolane-4-carbonyl)oxyethyl 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 122643704 |
| Molecular Formula | C10H10O10 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(2-oxo-1,3-dioxolane-4-carbonyl)oxyethyl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | O=C1OCC(C(=O)OCCOC(=O)C2COC(=O)O2)O1 |
| InChI | InChI=1S/C10H10O10/c11-7(5-3-17-9(13)19-5)15-1-2-16-8(12)6-4-18-10(14)20-6/h5-6H,1-4H2 |
| InChIKey | RRCAWFFCOWMSLK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|