C4H7NO3 — CID 22011126
4-(aminomethyl)-1,3-dioxolan-2-one (PubChem CID 22011126) has the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. Its IUPAC name is 4-(aminomethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(aminomethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 22011126 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 4-(aminomethyl)-1,3-dioxolan-2-one |
| SMILES | NCC1COC(=O)O1 |
| InChI | InChI=1S/C4H7NO3/c5-1-3-2-7-4(6)8-3/h3H,1-2,5H2 |
| InChIKey | TXLRZWSSXIZVGD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |