About acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one
acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one (PubChem CID 131738683) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one |
| PubChem CID | 131738683 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one |
| SMILES | CC(=O)O.O=C1OCC(CO)O1 |
| InChI | InChI=1S/C4H6O4.C2H4O2/c5-1-3-2-7-4(6)8-3;1-2(3)4/h3,5H,1-2H2;1H3,(H,3,4) |
| InChIKey | HVVZJRDHDQRYBT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one?
The IUPAC name of acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one (CID 131738683) is acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one.
What is the SMILES notation for acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one?
The canonical SMILES for acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one is CC(=O)O.O=C1OCC(CO)O1.
What is the InChIKey of acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one?
The InChIKey is HVVZJRDHDQRYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C2H4O2/c5-1-3-2-7-4(6)8-3;1-2(3)4/h3,5H,1-2H2;1H3,(H,3,4).
What are the key properties of acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one?
acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one has a molecular weight of 178.14 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 131738683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).