C6H10O6 — CID 131738683
acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one (PubChem CID 131738683) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one.
| Compound Name | acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 131738683 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | acetic acid;4-(hydroxymethyl)-1,3-dioxolan-2-one |
| SMILES | CC(=O)O.O=C1OCC(CO)O1 |
| InChI | InChI=1S/C4H6O4.C2H4O2/c5-1-3-2-7-4(6)8-3;1-2(3)4/h3,5H,1-2H2;1H3,(H,3,4) |
| InChIKey | HVVZJRDHDQRYBT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |