C5H8O4S — CID 141304527
4-(methylsulfinylmethyl)-1,3-dioxolan-2-one (PubChem CID 141304527) has the molecular formula C5H8O4S and a molecular weight of 164.18 g/mol. Its IUPAC name is 4-(methylsulfinylmethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(methylsulfinylmethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 141304527 |
| Molecular Formula | C5H8O4S |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | 4-(methylsulfinylmethyl)-1,3-dioxolan-2-one |
| SMILES | CS(=O)CC1COC(=O)O1 |
| InChI | InChI=1S/C5H8O4S/c1-10(7)3-4-2-8-5(6)9-4/h4H,2-3H2,1H3 |
| InChIKey | PTRLZGHSOQAFFF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |