C6H8F2O7S — CID 121354726
1,1-difluoro-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethanesulfonic acid (PubChem CID 121354726) has the molecular formula C6H8F2O7S and a molecular weight of 262.19 g/mol. Its IUPAC name is 1,1-difluoro-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 121354726 |
| Molecular Formula | C6H8F2O7S |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1,1-difluoro-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethanesulfonic acid |
| SMILES | O=C1OCC(COCC(F)(F)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C6H8F2O7S/c7-6(8,16(10,11)12)3-13-1-4-2-14-5(9)15-4/h4H,1-3H2,(H,10,11,12) |
| InChIKey | KEYNVQWVSXVAHP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|