C10H21O6Si2 — CID 58831271
CID 58831271 (PubChem CID 58831271) has the molecular formula C10H21O6Si2 and a molecular weight of 293.44 g/mol.
| Compound Name | CID 58831271 |
|---|---|
| PubChem CID | 58831271 |
| Molecular Formula | C10H21O6Si2 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](O)CCCOCC1COC(=O)O1 |
| InChI | InChI=1S/C10H21O6Si2/c1-18(2,3)16-17(12)6-4-5-13-7-9-8-14-10(11)15-9/h9,12H,4-8H2,1-3H3 |
| InChIKey | DQDCBLQWTWXSCF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|