C22H30O16 — CID 154528659
4-[[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]-3,3-bis[(2-oxo-1,3-dioxolan-4-yl)methoxymethyl]butoxy]methyl]-1,3-dioxolan-2-one (PubChem CID 154528659) has the molecular formula C22H30O16 and a molecular weight of 550.47 g/mol. Its IUPAC name is 4-[[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]-3,3-bis[(2-oxo-1,3-dioxolan-4-yl)methoxymethyl]butoxy]methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]-3,3-bis[(2-oxo-1,3-dioxolan-4-yl)methoxymethyl]butoxy]methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 154528659 |
| Molecular Formula | C22H30O16 |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 4-[[4-[(2-oxo-1,3-dioxolan-4-yl)methoxy]-3,3-bis[(2-oxo-1,3-dioxolan-4-yl)methoxymethyl]butoxy]methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COCCC(COCC2COC(=O)O2)(COCC2COC(=O)O2)COCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C22H30O16/c23-18-31-7-14(35-18)3-27-2-1-22(11-28-4-15-8-32-19(24)36-15,12-29-5-16-9-33-20(25)37-16)13-30-6-17-10-34-21(26)38-17/h14-17H,1-13H2 |
| InChIKey | GHHPFICXZLGMFL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|