C3H3NaO5P+ — CID 23709778
sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium (PubChem CID 23709778) has the molecular formula C3H3NaO5P+ and a molecular weight of 173.02 g/mol. Its IUPAC name is sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium.
| Compound Name | sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
|---|---|
| PubChem CID | 23709778 |
| Molecular Formula | C3H3NaO5P+ |
| Molecular Weight | 173.02 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
| SMILES | O=C1OCC([P+](=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C3H3O5P.Na/c4-3-7-1-2(8-3)9(5)6;/h2H,1H2;/q;+1 |
| InChIKey | HPEDHHVIQNVQBK-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.02 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|