About sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium
sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium (PubChem CID 23709778) has the molecular formula C3H3NaO5P+
and a molecular weight of 173.02 g/mol. Its IUPAC name is sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium.
Molecular Properties
| Compound Name | sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
| PubChem CID | 23709778 |
| Molecular Formula | C3H3NaO5P+ |
| Molecular Weight | 173.02 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
| SMILES | O=C1OCC([P+](=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C3H3O5P.Na/c4-3-7-1-2(8-3)9(5)6;/h2H,1H2;/q;+1 |
| InChIKey | HPEDHHVIQNVQBK-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.02 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium?
The IUPAC name of sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium (CID 23709778) is sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium.
What is the SMILES notation for sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium?
The canonical SMILES for sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium is O=C1OCC([P+](=O)[O-])O1.[Na+].
What is the InChIKey of sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium?
The InChIKey is HPEDHHVIQNVQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3O5P.Na/c4-3-7-1-2(8-3)9(5)6;/h2H,1H2;/q;+1.
What are the key properties of sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium?
sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium has a molecular weight of 173.02 g/mol, XLogP of -3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium is sourced from PubChem (CID 23709778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).