C3H3FO4 — CID 118636639
(2-oxo-1,3-dioxolan-4-yl) hypofluorite (PubChem CID 118636639) has the molecular formula C3H3FO4 and a molecular weight of 122.05 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl) hypofluorite.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl) hypofluorite |
|---|---|
| PubChem CID | 118636639 |
| Molecular Formula | C3H3FO4 |
| Molecular Weight | 122.05 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl) hypofluorite |
| SMILES | O=C1OCC(OF)O1 |
| InChI | InChI=1S/C3H3FO4/c4-8-2-1-6-3(5)7-2/h2H,1H2 |
| InChIKey | RJSXCMFZEHFOET-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.05 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |