C8H10O5 — CID 68583941
(2-oxo-1,3-dioxolan-4-yl) 2-methylbut-2-enoate (PubChem CID 68583941) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl) 2-methylbut-2-enoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 68583941 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1COC(=O)O1 |
| InChI | InChI=1S/C8H10O5/c1-3-5(2)7(9)12-6-4-11-8(10)13-6/h3,6H,4H2,1-2H3 |
| InChIKey | QPYIPDMBOWJSII-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|