C6H7FO6 — CID 157198471
1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one (PubChem CID 157198471) has the molecular formula C6H7FO6 and a molecular weight of 194.11 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one.
| Compound Name | 1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 157198471 |
| Molecular Formula | C6H7FO6 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(F)O1.O=C1OCCO1 |
| InChI | InChI=1S/C3H3FO3.C3H4O3/c4-2-1-6-3(5)7-2;4-3-5-1-2-6-3/h2H,1H2;1-2H2 |
| InChIKey | AQNHDRXYMSWXQP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |